C14H21ClN2O2S — CID 120999245
1-(2-chloro-5-propan-2-ylphenyl)sulfonyl-N-methylpyrrolidin-3-amine (PubChem CID 120999245) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is 1-(2-chloro-5-propan-2-ylphenyl)sulfonyl-N-methylpyrrolidin-3-amine.
| Compound Name | 1-(2-chloro-5-propan-2-ylphenyl)sulfonyl-N-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120999245 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-(2-chloro-5-propan-2-ylphenyl)sulfonyl-N-methylpyrrolidin-3-amine |
| SMILES | CNC1CCN(S(=O)(=O)c2cc(C(C)C)ccc2Cl)C1 |
| InChI | InChI=1S/C14H21ClN2O2S/c1-10(2)11-4-5-13(15)14(8-11)20(18,19)17-7-6-12(9-17)16-3/h4-5,8,10,12,16H,6-7,9H2,1-3H3 |
| InChIKey | SQRBPHBXYGPYHT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |