C14H18Cl3N3O2S — CID 67524094
(3S)-1-(4-chloroisoquinolin-5-yl)sulfonyl-N-methylpyrrolidin-3-amine;dihydrochloride (PubChem CID 67524094) has the molecular formula C14H18Cl3N3O2S and a molecular weight of 398.74 g/mol. Its IUPAC name is (3S)-1-(4-chloroisoquinolin-5-yl)sulfonyl-N-methylpyrrolidin-3-amine;dihydrochloride.
| Compound Name | (3S)-1-(4-chloroisoquinolin-5-yl)sulfonyl-N-methylpyrrolidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 67524094 |
| Molecular Formula | C14H18Cl3N3O2S |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | (3S)-1-(4-chloroisoquinolin-5-yl)sulfonyl-N-methylpyrrolidin-3-amine;dihydrochloride |
| SMILES | CN[C@H]1CCN(S(=O)(=O)c2cccc3cncc(Cl)c23)C1.Cl.Cl |
| InChI | InChI=1S/C14H16ClN3O2S.2ClH/c1-16-11-5-6-18(9-11)21(19,20)13-4-2-3-10-7-17-8-12(15)14(10)13;;/h2-4,7-8,11,16H,5-6,9H2,1H3;2*1H/t11-;;/m0../s1 |
| InChIKey | KQPWSJYHXPDDPG-IDMXKUIJSA-N |
| XLogP | 2.71 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |