C20H26N4O4S — CID 71030947
N-[(3R)-1-(4-methylisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]-2-morpholin-4-ylacetamide (PubChem CID 71030947) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[(3R)-1-(4-methylisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[(3R)-1-(4-methylisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 71030947 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-[(3R)-1-(4-methylisoquinolin-5-yl)sulfonylpyrrolidin-3-yl]-2-morpholin-4-ylacetamide |
| SMILES | Cc1cncc2cccc(S(=O)(=O)N3CC[C@@H](NC(=O)CN4CCOCC4)C3)c12 |
| InChI | InChI=1S/C20H26N4O4S/c1-15-11-21-12-16-3-2-4-18(20(15)16)29(26,27)24-6-5-17(13-24)22-19(25)14-23-7-9-28-10-8-23/h2-4,11-12,17H,5-10,13-14H2,1H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | BKILOHCWVCFPLN-QGZVFWFLSA-N |
| XLogP | 0.75 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |