C15H21Cl2N3O2S — CID 22121915
4-methyl-5-(3-methylpiperazin-1-yl)sulfonylisoquinoline;dihydrochloride (PubChem CID 22121915) has the molecular formula C15H21Cl2N3O2S and a molecular weight of 378.33 g/mol. Its IUPAC name is 4-methyl-5-(3-methylpiperazin-1-yl)sulfonylisoquinoline;dihydrochloride.
| Compound Name | 4-methyl-5-(3-methylpiperazin-1-yl)sulfonylisoquinoline;dihydrochloride |
|---|---|
| PubChem CID | 22121915 |
| Molecular Formula | C15H21Cl2N3O2S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 4-methyl-5-(3-methylpiperazin-1-yl)sulfonylisoquinoline;dihydrochloride |
| SMILES | Cc1cncc2cccc(S(=O)(=O)N3CCNC(C)C3)c12.Cl.Cl |
| InChI | InChI=1S/C15H19N3O2S.2ClH/c1-11-8-16-9-13-4-3-5-14(15(11)13)21(19,20)18-7-6-17-12(2)10-18;;/h3-5,8-9,12,17H,6-7,10H2,1-2H3;2*1H |
| InChIKey | BWIAYQUKFSATBX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |