C11H15BrClFN2O2S — CID 120710424
1-(3-bromo-2-fluorophenyl)sulfonyl-3-methylpiperazine;hydrochloride (PubChem CID 120710424) has the molecular formula C11H15BrClFN2O2S and a molecular weight of 373.68 g/mol. Its IUPAC name is 1-(3-bromo-2-fluorophenyl)sulfonyl-3-methylpiperazine;hydrochloride.
| Compound Name | 1-(3-bromo-2-fluorophenyl)sulfonyl-3-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120710424 |
| Molecular Formula | C11H15BrClFN2O2S |
| Molecular Weight | 373.68 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 1-(3-bromo-2-fluorophenyl)sulfonyl-3-methylpiperazine;hydrochloride |
| SMILES | CC1CN(S(=O)(=O)c2cccc(Br)c2F)CCN1.Cl |
| InChI | InChI=1S/C11H14BrFN2O2S.ClH/c1-8-7-15(6-5-14-8)18(16,17)10-4-2-3-9(12)11(10)13;/h2-4,8,14H,5-7H2,1H3;1H |
| InChIKey | OOWPEHDEWKATHA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |