C16H21ClN2O2S — CID 120714484
N-methyl-1-naphthalen-1-ylsulfonylpiperidin-3-amine;hydrochloride (PubChem CID 120714484) has the molecular formula C16H21ClN2O2S and a molecular weight of 340.88 g/mol. Its IUPAC name is N-methyl-1-naphthalen-1-ylsulfonylpiperidin-3-amine;hydrochloride.
| Compound Name | N-methyl-1-naphthalen-1-ylsulfonylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120714484 |
| Molecular Formula | C16H21ClN2O2S |
| Molecular Weight | 340.88 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-methyl-1-naphthalen-1-ylsulfonylpiperidin-3-amine;hydrochloride |
| SMILES | CNC1CCCN(S(=O)(=O)c2cccc3ccccc23)C1.Cl |
| InChI | InChI=1S/C16H20N2O2S.ClH/c1-17-14-8-5-11-18(12-14)21(19,20)16-10-4-7-13-6-2-3-9-15(13)16;/h2-4,6-7,9-10,14,17H,5,8,11-12H2,1H3;1H |
| InChIKey | GALKXHSODHWUPF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.88 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |