C17H23N3O2S — CID 14326760
1-isoquinolin-5-ylsulfonyl-N-propylpiperidin-3-amine (PubChem CID 14326760) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 1-isoquinolin-5-ylsulfonyl-N-propylpiperidin-3-amine.
| Compound Name | 1-isoquinolin-5-ylsulfonyl-N-propylpiperidin-3-amine |
|---|---|
| PubChem CID | 14326760 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 1-isoquinolin-5-ylsulfonyl-N-propylpiperidin-3-amine |
| SMILES | CCCNC1CCCN(S(=O)(=O)c2cccc3cnccc23)C1 |
| InChI | InChI=1S/C17H23N3O2S/c1-2-9-19-15-6-4-11-20(13-15)23(21,22)17-7-3-5-14-12-18-10-8-16(14)17/h3,5,7-8,10,12,15,19H,2,4,6,9,11,13H2,1H3 |
| InChIKey | KTCXFPPIPOPFIT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |