C14H17N3O3S — CID 57333975
5-[(4-hydroxy-1,4-diazepan-1-yl)sulfonyl]isoquinoline (PubChem CID 57333975) has the molecular formula C14H17N3O3S and a molecular weight of 307.37 g/mol. Its IUPAC name is 5-[(4-hydroxy-1,4-diazepan-1-yl)sulfonyl]isoquinoline.
| Compound Name | 5-[(4-hydroxy-1,4-diazepan-1-yl)sulfonyl]isoquinoline |
|---|---|
| PubChem CID | 57333975 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 5-[(4-hydroxy-1,4-diazepan-1-yl)sulfonyl]isoquinoline |
| SMILES | O=S(=O)(c1cccc2cnccc12)N1CCCN(O)CC1 |
| InChI | InChI=1S/C14H17N3O3S/c18-16-7-2-8-17(10-9-16)21(19,20)14-4-1-3-12-11-15-6-5-13(12)14/h1,3-6,11,18H,2,7-10H2 |
| InChIKey | NBHSGLNVSCYWBA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |