C13H16ClN3O2S — CID 119971621
1-isoquinolin-5-ylsulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 119971621) has the molecular formula C13H16ClN3O2S and a molecular weight of 313.81 g/mol. Its IUPAC name is 1-isoquinolin-5-ylsulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-isoquinolin-5-ylsulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119971621 |
| Molecular Formula | C13H16ClN3O2S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 1-isoquinolin-5-ylsulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCN(S(=O)(=O)c2cccc3cnccc23)C1 |
| InChI | InChI=1S/C13H15N3O2S.ClH/c14-11-5-7-16(9-11)19(17,18)13-3-1-2-10-8-15-6-4-12(10)13;/h1-4,6,8,11H,5,7,9,14H2;1H |
| InChIKey | DXMXYSVJDWSLFW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |