C13H17Cl2N3O2S — CID 66727171
1-isoquinolin-6-ylsulfonylpyrrolidin-3-amine;dihydrochloride (PubChem CID 66727171) has the molecular formula C13H17Cl2N3O2S and a molecular weight of 350.27 g/mol. Its IUPAC name is 1-isoquinolin-6-ylsulfonylpyrrolidin-3-amine;dihydrochloride.
| Compound Name | 1-isoquinolin-6-ylsulfonylpyrrolidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 66727171 |
| Molecular Formula | C13H17Cl2N3O2S |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 1-isoquinolin-6-ylsulfonylpyrrolidin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(S(=O)(=O)c2ccc3cnccc3c2)C1 |
| InChI | InChI=1S/C13H15N3O2S.2ClH/c14-12-4-6-16(9-12)19(17,18)13-2-1-11-8-15-5-3-10(11)7-13;;/h1-3,5,7-8,12H,4,6,9,14H2;2*1H |
| InChIKey | QNBGSARJPUJLSJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |