C14H15N3O2S — CID 166304073
6-(3,6-diazabicyclo[3.1.1]heptan-3-ylsulfonyl)isoquinoline (PubChem CID 166304073) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is 6-(3,6-diazabicyclo[3.1.1]heptan-3-ylsulfonyl)isoquinoline.
| Compound Name | 6-(3,6-diazabicyclo[3.1.1]heptan-3-ylsulfonyl)isoquinoline |
|---|---|
| PubChem CID | 166304073 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 6-(3,6-diazabicyclo[3.1.1]heptan-3-ylsulfonyl)isoquinoline |
| SMILES | O=S(=O)(c1ccc2cnccc2c1)N1CC2CC(C1)N2 |
| InChI | InChI=1S/C14H15N3O2S/c18-20(19,17-8-12-6-13(9-17)16-12)14-2-1-11-7-15-4-3-10(11)5-14/h1-5,7,12-13,16H,6,8-9H2 |
| InChIKey | LOPPIJMHTJPAQM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |