C16H21N3O3S — CID 154782948
1-isoquinolin-5-ylsulfonyl-N-methoxy-N-methylpiperidin-4-amine (PubChem CID 154782948) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-isoquinolin-5-ylsulfonyl-N-methoxy-N-methylpiperidin-4-amine.
| Compound Name | 1-isoquinolin-5-ylsulfonyl-N-methoxy-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 154782948 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-isoquinolin-5-ylsulfonyl-N-methoxy-N-methylpiperidin-4-amine |
| SMILES | CON(C)C1CCN(S(=O)(=O)c2cccc3cnccc23)CC1 |
| InChI | InChI=1S/C16H21N3O3S/c1-18(22-2)14-7-10-19(11-8-14)23(20,21)16-5-3-4-13-12-17-9-6-15(13)16/h3-6,9,12,14H,7-8,10-11H2,1-2H3 |
| InChIKey | NCDURDCAMUIZEA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|