C18H20N4O4S — CID 166412324
N-[2-(4-isoquinolin-5-ylsulfonylpiperazin-1-yl)-2-oxoethyl]prop-2-enamide (PubChem CID 166412324) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is N-[2-(4-isoquinolin-5-ylsulfonylpiperazin-1-yl)-2-oxoethyl]prop-2-enamide.
| Compound Name | N-[2-(4-isoquinolin-5-ylsulfonylpiperazin-1-yl)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 166412324 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[2-(4-isoquinolin-5-ylsulfonylpiperazin-1-yl)-2-oxoethyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(=O)N1CCN(S(=O)(=O)c2cccc3cnccc23)CC1 |
| InChI | InChI=1S/C18H20N4O4S/c1-2-17(23)20-13-18(24)21-8-10-22(11-9-21)27(25,26)16-5-3-4-14-12-19-7-6-15(14)16/h2-7,12H,1,8-11,13H2,(H,20,23) |
| InChIKey | OYHFERSIKOVKPV-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|