About 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline
5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline (PubChem CID 22393189) has the molecular formula C18H25N3O2S
and a molecular weight of 347.48 g/mol. Its IUPAC name is 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline.
Molecular Properties
| Compound Name | 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline |
| PubChem CID | 22393189 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline |
| SMILES | CCCCC1CNCCN(S(=O)(=O)c2cccc3cnccc23)C1 |
| InChI | InChI=1S/C18H25N3O2S/c1-2-3-5-15-12-20-10-11-21(14-15)24(22,23)18-7-4-6-16-13-19-9-8-17(16)18/h4,6-9,13,15,20H,2-3,5,10-12,14H2,1H3 |
| InChIKey | ZORUZQHLSMGYFV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline?
The IUPAC name of 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline (CID 22393189) is 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline.
What is the SMILES notation for 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline?
The canonical SMILES for 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline is CCCCC1CNCCN(S(=O)(=O)c2cccc3cnccc23)C1.
What is the InChIKey of 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline?
The InChIKey is ZORUZQHLSMGYFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O2S/c1-2-3-5-15-12-20-10-11-21(14-15)24(22,23)18-7-4-6-16-13-19-9-8-17(16)18/h4,6-9,13,15,20H,2-3,5,10-12,14H2,1H3.
What are the key properties of 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline?
5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline has a molecular weight of 347.48 g/mol, XLogP of 2.64, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-butyl-1,4-diazepan-1-yl)sulfonyl]isoquinoline is sourced from PubChem (CID 22393189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).