C22H28ClN3O5S2 — CID 57430502
4-[2-[4-[5-(benzenesulfonyl)-2-chlorophenyl]sulfonylpiperazin-1-yl]ethyl]morpholine (PubChem CID 57430502) has the molecular formula C22H28ClN3O5S2 and a molecular weight of 514.07 g/mol. Its IUPAC name is 4-[2-[4-[5-(benzenesulfonyl)-2-chlorophenyl]sulfonylpiperazin-1-yl]ethyl]morpholine.
| Compound Name | 4-[2-[4-[5-(benzenesulfonyl)-2-chlorophenyl]sulfonylpiperazin-1-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 57430502 |
| Molecular Formula | C22H28ClN3O5S2 |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 4-[2-[4-[5-(benzenesulfonyl)-2-chlorophenyl]sulfonylpiperazin-1-yl]ethyl]morpholine |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(Cl)c(S(=O)(=O)N2CCN(CCN3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C22H28ClN3O5S2/c23-21-7-6-20(32(27,28)19-4-2-1-3-5-19)18-22(21)33(29,30)26-12-10-24(11-13-26)8-9-25-14-16-31-17-15-25/h1-7,18H,8-17H2 |
| InChIKey | PXUMHAXEEFWRFU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |