C17H19NO5S2 — CID 1097196
4-[5-(benzenesulfonyl)-2-methylphenyl]sulfonylmorpholine (PubChem CID 1097196) has the molecular formula C17H19NO5S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[5-(benzenesulfonyl)-2-methylphenyl]sulfonylmorpholine.
| Compound Name | 4-[5-(benzenesulfonyl)-2-methylphenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 1097196 |
| Molecular Formula | C17H19NO5S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-[5-(benzenesulfonyl)-2-methylphenyl]sulfonylmorpholine |
| SMILES | Cc1ccc(S(=O)(=O)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H19NO5S2/c1-14-7-8-16(24(19,20)15-5-3-2-4-6-15)13-17(14)25(21,22)18-9-11-23-12-10-18/h2-8,13H,9-12H2,1H3 |
| InChIKey | CVXIPZBGCJNGJW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |