C17H25N3O5S — CID 113073744
4-[2-[4-(1,3-benzodioxol-5-ylsulfonyl)piperazin-1-yl]ethyl]morpholine (PubChem CID 113073744) has the molecular formula C17H25N3O5S and a molecular weight of 383.47 g/mol. Its IUPAC name is 4-[2-[4-(1,3-benzodioxol-5-ylsulfonyl)piperazin-1-yl]ethyl]morpholine.
| Compound Name | 4-[2-[4-(1,3-benzodioxol-5-ylsulfonyl)piperazin-1-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 113073744 |
| Molecular Formula | C17H25N3O5S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 4-[2-[4-(1,3-benzodioxol-5-ylsulfonyl)piperazin-1-yl]ethyl]morpholine |
| SMILES | O=S(=O)(c1ccc2c(c1)OCO2)N1CCN(CCN2CCOCC2)CC1 |
| InChI | InChI=1S/C17H25N3O5S/c21-26(22,15-1-2-16-17(13-15)25-14-24-16)20-7-5-18(6-8-20)3-4-19-9-11-23-12-10-19/h1-2,13H,3-12,14H2 |
| InChIKey | OZVPYQUSAXJISC-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |