C17H19N3O4S — CID 113074190
1-(1,3-benzodioxol-5-ylsulfonyl)-4-(pyridin-3-ylmethyl)piperazine (PubChem CID 113074190) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylsulfonyl)-4-(pyridin-3-ylmethyl)piperazine.
| Compound Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-4-(pyridin-3-ylmethyl)piperazine |
|---|---|
| PubChem CID | 113074190 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylsulfonyl)-4-(pyridin-3-ylmethyl)piperazine |
| SMILES | O=S(=O)(c1ccc2c(c1)OCO2)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C17H19N3O4S/c21-25(22,15-3-4-16-17(10-15)24-13-23-16)20-8-6-19(7-9-20)12-14-2-1-5-18-11-14/h1-5,10-11H,6-9,12-13H2 |
| InChIKey | KUKAOJSDFCMVCZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |