C14H17F3N2O4S — CID 47065048
ethyl N-[1-(2,3,4-trifluorophenyl)sulfonylpiperidin-3-yl]carbamate (PubChem CID 47065048) has the molecular formula C14H17F3N2O4S and a molecular weight of 366.36 g/mol. Its IUPAC name is ethyl N-[1-(2,3,4-trifluorophenyl)sulfonylpiperidin-3-yl]carbamate.
| Compound Name | ethyl N-[1-(2,3,4-trifluorophenyl)sulfonylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 47065048 |
| Molecular Formula | C14H17F3N2O4S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | ethyl N-[1-(2,3,4-trifluorophenyl)sulfonylpiperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(S(=O)(=O)c2ccc(F)c(F)c2F)C1 |
| InChI | InChI=1S/C14H17F3N2O4S/c1-2-23-14(20)18-9-4-3-7-19(8-9)24(21,22)11-6-5-10(15)12(16)13(11)17/h5-6,9H,2-4,7-8H2,1H3,(H,18,20) |
| InChIKey | TXUAZBSGTIARKT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|