C14H27N3O4S — CID 94638446
ethyl N-[(3S)-1-[(3S)-3-methylpiperidin-1-yl]sulfonylpiperidin-3-yl]carbamate (PubChem CID 94638446) has the molecular formula C14H27N3O4S and a molecular weight of 333.45 g/mol. Its IUPAC name is ethyl N-[(3S)-1-[(3S)-3-methylpiperidin-1-yl]sulfonylpiperidin-3-yl]carbamate.
| Compound Name | ethyl N-[(3S)-1-[(3S)-3-methylpiperidin-1-yl]sulfonylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 94638446 |
| Molecular Formula | C14H27N3O4S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethyl N-[(3S)-1-[(3S)-3-methylpiperidin-1-yl]sulfonylpiperidin-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@H]1CCCN(S(=O)(=O)N2CCC[C@H](C)C2)C1 |
| InChI | InChI=1S/C14H27N3O4S/c1-3-21-14(18)15-13-7-5-9-17(11-13)22(19,20)16-8-4-6-12(2)10-16/h12-13H,3-11H2,1-2H3,(H,15,18)/t12-,13-/m0/s1 |
| InChIKey | XIZPIKWEEUTCDC-STQMWFEESA-N |
| XLogP | 1.17 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |