C16H25N3O6S2 — CID 96540850
ethyl N-[(3S)-1-[2-(benzenesulfonamido)ethylsulfonyl]piperidin-3-yl]carbamate (PubChem CID 96540850) has the molecular formula C16H25N3O6S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is ethyl N-[(3S)-1-[2-(benzenesulfonamido)ethylsulfonyl]piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[(3S)-1-[2-(benzenesulfonamido)ethylsulfonyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 96540850 |
| Molecular Formula | C16H25N3O6S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | ethyl N-[(3S)-1-[2-(benzenesulfonamido)ethylsulfonyl]piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@H]1CCCN(S(=O)(=O)CCNS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H25N3O6S2/c1-2-25-16(20)18-14-7-6-11-19(13-14)26(21,22)12-10-17-27(23,24)15-8-4-3-5-9-15/h3-5,8-9,14,17H,2,6-7,10-13H2,1H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | VCZPPODKXFHQRI-AWEZNQCLSA-N |
| XLogP | 0.51 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |