C15H22N2O4S — CID 95331654
N-[(3R)-1-(2-ethoxyacetyl)piperidin-3-yl]benzenesulfonamide (PubChem CID 95331654) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-[(3R)-1-(2-ethoxyacetyl)piperidin-3-yl]benzenesulfonamide.
| Compound Name | N-[(3R)-1-(2-ethoxyacetyl)piperidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 95331654 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-[(3R)-1-(2-ethoxyacetyl)piperidin-3-yl]benzenesulfonamide |
| SMILES | CCOCC(=O)N1CCC[C@@H](NS(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C15H22N2O4S/c1-2-21-12-15(18)17-10-6-7-13(11-17)16-22(19,20)14-8-4-3-5-9-14/h3-5,8-9,13,16H,2,6-7,10-12H2,1H3/t13-/m1/s1 |
| InChIKey | XFAKPKHGDGNSDB-CYBMUJFWSA-N |
| XLogP | 0.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |