C17H25BrN2O4S — CID 97171763
tert-butyl (3R)-3-[[3-(bromomethyl)phenyl]sulfonylamino]piperidine-1-carboxylate (PubChem CID 97171763) has the molecular formula C17H25BrN2O4S and a molecular weight of 433.37 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[3-(bromomethyl)phenyl]sulfonylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[3-(bromomethyl)phenyl]sulfonylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 97171763 |
| Molecular Formula | C17H25BrN2O4S |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | tert-butyl (3R)-3-[[3-(bromomethyl)phenyl]sulfonylamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H](NS(=O)(=O)c2cccc(CBr)c2)C1 |
| InChI | InChI=1S/C17H25BrN2O4S/c1-17(2,3)24-16(21)20-9-5-7-14(12-20)19-25(22,23)15-8-4-6-13(10-15)11-18/h4,6,8,10,14,19H,5,7,9,11-12H2,1-3H3/t14-/m1/s1 |
| InChIKey | WFUPSZHZOJAHIO-CQSZACIVSA-N |
| XLogP | 3.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|