C13H21N3O4S2 — CID 119989094
N-[2-[2-(aminomethyl)pyrrolidin-1-yl]sulfonylethyl]benzenesulfonamide (PubChem CID 119989094) has the molecular formula C13H21N3O4S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is N-[2-[2-(aminomethyl)pyrrolidin-1-yl]sulfonylethyl]benzenesulfonamide.
| Compound Name | N-[2-[2-(aminomethyl)pyrrolidin-1-yl]sulfonylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 119989094 |
| Molecular Formula | C13H21N3O4S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-[2-[2-(aminomethyl)pyrrolidin-1-yl]sulfonylethyl]benzenesulfonamide |
| SMILES | NCC1CCCN1S(=O)(=O)CCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H21N3O4S2/c14-11-12-5-4-9-16(12)21(17,18)10-8-15-22(19,20)13-6-2-1-3-7-13/h1-3,6-7,12,15H,4-5,8-11,14H2 |
| InChIKey | PRNJUMWLVOUGHS-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |