C18H34N4O3 — CID 87005476
ethyl N-[1-[2-(3-methylpiperidin-1-yl)propylcarbamoyl]piperidin-3-yl]carbamate (PubChem CID 87005476) has the molecular formula C18H34N4O3 and a molecular weight of 354.50 g/mol. Its IUPAC name is ethyl N-[1-[2-(3-methylpiperidin-1-yl)propylcarbamoyl]piperidin-3-yl]carbamate.
| Compound Name | ethyl N-[1-[2-(3-methylpiperidin-1-yl)propylcarbamoyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 87005476 |
| Molecular Formula | C18H34N4O3 |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | ethyl N-[1-[2-(3-methylpiperidin-1-yl)propylcarbamoyl]piperidin-3-yl]carbamate |
| SMILES | CCOC(=O)NC1CCCN(C(=O)NCC(C)N2CCCC(C)C2)C1 |
| InChI | InChI=1S/C18H34N4O3/c1-4-25-18(24)20-16-8-6-10-22(13-16)17(23)19-11-15(3)21-9-5-7-14(2)12-21/h14-16H,4-13H2,1-3H3,(H,19,23)(H,20,24) |
| InChIKey | IEVDNGYVHWKOFO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |