C15H30N4O3S — CID 98752850
N-[(2R)-2-[(3S)-3-methylpiperidin-1-yl]propyl]-4-methylsulfonylpiperazine-1-carboxamide (PubChem CID 98752850) has the molecular formula C15H30N4O3S and a molecular weight of 346.50 g/mol. Its IUPAC name is N-[(2R)-2-[(3S)-3-methylpiperidin-1-yl]propyl]-4-methylsulfonylpiperazine-1-carboxamide.
| Compound Name | N-[(2R)-2-[(3S)-3-methylpiperidin-1-yl]propyl]-4-methylsulfonylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 98752850 |
| Molecular Formula | C15H30N4O3S |
| Molecular Weight | 346.50 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[(2R)-2-[(3S)-3-methylpiperidin-1-yl]propyl]-4-methylsulfonylpiperazine-1-carboxamide |
| SMILES | C[C@H]1CCCN([C@H](C)CNC(=O)N2CCN(S(C)(=O)=O)CC2)C1 |
| InChI | InChI=1S/C15H30N4O3S/c1-13-5-4-6-18(12-13)14(2)11-16-15(20)17-7-9-19(10-8-17)23(3,21)22/h13-14H,4-12H2,1-3H3,(H,16,20)/t13-,14+/m0/s1 |
| InChIKey | DLDMFUSBVOURSC-UONOGXRCSA-N |
| XLogP | 0.39 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.50 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |