C19H36N4O — CID 60597940
4-cyclopentyl-N-[2-(4-methylpiperidin-1-yl)propyl]piperazine-1-carboxamide (PubChem CID 60597940) has the molecular formula C19H36N4O and a molecular weight of 336.52 g/mol. Its IUPAC name is 4-cyclopentyl-N-[2-(4-methylpiperidin-1-yl)propyl]piperazine-1-carboxamide.
| Compound Name | 4-cyclopentyl-N-[2-(4-methylpiperidin-1-yl)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 60597940 |
| Molecular Formula | C19H36N4O |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.29 |
| IUPAC Name | 4-cyclopentyl-N-[2-(4-methylpiperidin-1-yl)propyl]piperazine-1-carboxamide |
| SMILES | CC1CCN(C(C)CNC(=O)N2CCN(C3CCCC3)CC2)CC1 |
| InChI | InChI=1S/C19H36N4O/c1-16-7-9-21(10-8-16)17(2)15-20-19(24)23-13-11-22(12-14-23)18-5-3-4-6-18/h16-18H,3-15H2,1-2H3,(H,20,24) |
| InChIKey | JXUHXEXYMZTKLI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |