C14H14F3NO4S — CID 136542506
cyclopropyl-[4-(2,3,4-trifluorophenyl)sulfonylmorpholin-2-yl]methanone (PubChem CID 136542506) has the molecular formula C14H14F3NO4S and a molecular weight of 349.33 g/mol. Its IUPAC name is cyclopropyl-[4-(2,3,4-trifluorophenyl)sulfonylmorpholin-2-yl]methanone.
| Compound Name | cyclopropyl-[4-(2,3,4-trifluorophenyl)sulfonylmorpholin-2-yl]methanone |
|---|---|
| PubChem CID | 136542506 |
| Molecular Formula | C14H14F3NO4S |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | cyclopropyl-[4-(2,3,4-trifluorophenyl)sulfonylmorpholin-2-yl]methanone |
| SMILES | O=C(C1CC1)C1CN(S(=O)(=O)c2ccc(F)c(F)c2F)CCO1 |
| InChI | InChI=1S/C14H14F3NO4S/c15-9-3-4-11(13(17)12(9)16)23(20,21)18-5-6-22-10(7-18)14(19)8-1-2-8/h3-4,8,10H,1-2,5-7H2 |
| InChIKey | GFGALESPTWFTAW-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|