C11H13F3N2O3S — CID 114398416
[4-(2,3,4-trifluorophenyl)sulfonylmorpholin-2-yl]methanamine (PubChem CID 114398416) has the molecular formula C11H13F3N2O3S and a molecular weight of 310.30 g/mol. Its IUPAC name is [4-(2,3,4-trifluorophenyl)sulfonylmorpholin-2-yl]methanamine.
| Compound Name | [4-(2,3,4-trifluorophenyl)sulfonylmorpholin-2-yl]methanamine |
|---|---|
| PubChem CID | 114398416 |
| Molecular Formula | C11H13F3N2O3S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | [4-(2,3,4-trifluorophenyl)sulfonylmorpholin-2-yl]methanamine |
| SMILES | NCC1CN(S(=O)(=O)c2ccc(F)c(F)c2F)CCO1 |
| InChI | InChI=1S/C11H13F3N2O3S/c12-8-1-2-9(11(14)10(8)13)20(17,18)16-3-4-19-7(5-15)6-16/h1-2,7H,3-6,15H2 |
| InChIKey | SRTQKQKQIHORTJ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|