C10H14BrNO3S2 — CID 103931361
(2S,6R)-4-(3-bromothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine (PubChem CID 103931361) has the molecular formula C10H14BrNO3S2 and a molecular weight of 340.26 g/mol. Its IUPAC name is (2S,6R)-4-(3-bromothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-(3-bromothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 103931361 |
| Molecular Formula | C10H14BrNO3S2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 338.96 |
| IUPAC Name | (2S,6R)-4-(3-bromothiophen-2-yl)sulfonyl-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2sccc2Br)C[C@H](C)O1 |
| InChI | InChI=1S/C10H14BrNO3S2/c1-7-5-12(6-8(2)15-7)17(13,14)10-9(11)3-4-16-10/h3-4,7-8H,5-6H2,1-2H3/t7-,8+ |
| InChIKey | HTFBFSNBFQSMJS-OCAPTIKFSA-N |
| XLogP | 2.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |