C10H14BrNO3S2 — CID 103896811
1-(3-bromothiophen-2-yl)sulfonyl-4-methylpiperidin-3-ol (PubChem CID 103896811) has the molecular formula C10H14BrNO3S2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)sulfonyl-4-methylpiperidin-3-ol.
| Compound Name | 1-(3-bromothiophen-2-yl)sulfonyl-4-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 103896811 |
| Molecular Formula | C10H14BrNO3S2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 338.96 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)sulfonyl-4-methylpiperidin-3-ol |
| SMILES | CC1CCN(S(=O)(=O)c2sccc2Br)CC1O |
| InChI | InChI=1S/C10H14BrNO3S2/c1-7-2-4-12(6-9(7)13)17(14,15)10-8(11)3-5-16-10/h3,5,7,9,13H,2,4,6H2,1H3 |
| InChIKey | BVUJQFGAHRYWPJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |