C8H11BrN2O2S2 — CID 115302272
(3S)-1-(3-bromothiophen-2-yl)sulfonylpyrrolidin-3-amine (PubChem CID 115302272) has the molecular formula C8H11BrN2O2S2 and a molecular weight of 311.23 g/mol. Its IUPAC name is (3S)-1-(3-bromothiophen-2-yl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3S)-1-(3-bromothiophen-2-yl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115302272 |
| Molecular Formula | C8H11BrN2O2S2 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 309.94 |
| IUPAC Name | (3S)-1-(3-bromothiophen-2-yl)sulfonylpyrrolidin-3-amine |
| SMILES | N[C@H]1CCN(S(=O)(=O)c2sccc2Br)C1 |
| InChI | InChI=1S/C8H11BrN2O2S2/c9-7-2-4-14-8(7)15(12,13)11-3-1-6(10)5-11/h2,4,6H,1,3,5,10H2/t6-/m0/s1 |
| InChIKey | PLZHUOSPFSLWGI-LURJTMIESA-N |
| XLogP | 1.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |