C11H12BrNO6S2 — CID 115917687
1-(3-bromothiophen-2-yl)sulfonylpiperidine-3,4-dicarboxylic acid (PubChem CID 115917687) has the molecular formula C11H12BrNO6S2 and a molecular weight of 398.26 g/mol. Its IUPAC name is 1-(3-bromothiophen-2-yl)sulfonylpiperidine-3,4-dicarboxylic acid.
| Compound Name | 1-(3-bromothiophen-2-yl)sulfonylpiperidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 115917687 |
| Molecular Formula | C11H12BrNO6S2 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 396.93 |
| IUPAC Name | 1-(3-bromothiophen-2-yl)sulfonylpiperidine-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCN(S(=O)(=O)c2sccc2Br)CC1C(=O)O |
| InChI | InChI=1S/C11H12BrNO6S2/c12-8-2-4-20-11(8)21(18,19)13-3-1-6(9(14)15)7(5-13)10(16)17/h2,4,6-7H,1,3,5H2,(H,14,15)(H,16,17) |
| InChIKey | AATZUJIUYYWYQX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |