C11H15BrN2O3S2 — CID 113228721
N-[1-(3-bromothiophen-2-yl)sulfonylpiperidin-4-yl]acetamide (PubChem CID 113228721) has the molecular formula C11H15BrN2O3S2 and a molecular weight of 367.29 g/mol. Its IUPAC name is N-[1-(3-bromothiophen-2-yl)sulfonylpiperidin-4-yl]acetamide.
| Compound Name | N-[1-(3-bromothiophen-2-yl)sulfonylpiperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 113228721 |
| Molecular Formula | C11H15BrN2O3S2 |
| Molecular Weight | 367.29 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | N-[1-(3-bromothiophen-2-yl)sulfonylpiperidin-4-yl]acetamide |
| SMILES | CC(=O)NC1CCN(S(=O)(=O)c2sccc2Br)CC1 |
| InChI | InChI=1S/C11H15BrN2O3S2/c1-8(15)13-9-2-5-14(6-3-9)19(16,17)11-10(12)4-7-18-11/h4,7,9H,2-3,5-6H2,1H3,(H,13,15) |
| InChIKey | QUWXVKJEYRUITB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |