C8H10BrNO3S2 — CID 66291405
(3R)-1-(3-bromothiophen-2-yl)sulfonylpyrrolidin-3-ol (PubChem CID 66291405) has the molecular formula C8H10BrNO3S2 and a molecular weight of 312.21 g/mol. Its IUPAC name is (3R)-1-(3-bromothiophen-2-yl)sulfonylpyrrolidin-3-ol.
| Compound Name | (3R)-1-(3-bromothiophen-2-yl)sulfonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 66291405 |
| Molecular Formula | C8H10BrNO3S2 |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 310.93 |
| IUPAC Name | (3R)-1-(3-bromothiophen-2-yl)sulfonylpyrrolidin-3-ol |
| SMILES | O=S(=O)(c1sccc1Br)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C8H10BrNO3S2/c9-7-2-4-14-8(7)15(12,13)10-3-1-6(11)5-10/h2,4,6,11H,1,3,5H2/t6-/m1/s1 |
| InChIKey | JENAWVGOKOYGKP-ZCFIWIBFSA-N |
| XLogP | 1.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |