C12H24N2O4S — CID 54878650
[1-(2,6-dimethylmorpholin-4-yl)sulfonylpiperidin-4-yl]methanol (PubChem CID 54878650) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is [1-(2,6-dimethylmorpholin-4-yl)sulfonylpiperidin-4-yl]methanol.
| Compound Name | [1-(2,6-dimethylmorpholin-4-yl)sulfonylpiperidin-4-yl]methanol |
|---|---|
| PubChem CID | 54878650 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | [1-(2,6-dimethylmorpholin-4-yl)sulfonylpiperidin-4-yl]methanol |
| SMILES | CC1CN(S(=O)(=O)N2CCC(CO)CC2)CC(C)O1 |
| InChI | InChI=1S/C12H24N2O4S/c1-10-7-14(8-11(2)18-10)19(16,17)13-5-3-12(9-15)4-6-13/h10-12,15H,3-9H2,1-2H3 |
| InChIKey | MITOCQFLNJLVIH-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |