C12H22N2O5S — CID 60858430
1-[4-(hydroxymethyl)piperidin-1-yl]sulfonylpiperidine-4-carboxylic acid (PubChem CID 60858430) has the molecular formula C12H22N2O5S and a molecular weight of 306.38 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)piperidin-1-yl]sulfonylpiperidine-4-carboxylic acid.
| Compound Name | 1-[4-(hydroxymethyl)piperidin-1-yl]sulfonylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 60858430 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-[4-(hydroxymethyl)piperidin-1-yl]sulfonylpiperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(S(=O)(=O)N2CCC(CO)CC2)CC1 |
| InChI | InChI=1S/C12H22N2O5S/c15-9-10-1-5-13(6-2-10)20(18,19)14-7-3-11(4-8-14)12(16)17/h10-11,15H,1-9H2,(H,16,17) |
| InChIKey | OVTYUHAQADUTDN-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |