C9H19ClN2O3S — CID 107652652
2-[4-(2-chloroethylsulfonyl)-1,4-diazepan-1-yl]ethanol (PubChem CID 107652652) has the molecular formula C9H19ClN2O3S and a molecular weight of 270.78 g/mol. Its IUPAC name is 2-[4-(2-chloroethylsulfonyl)-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-(2-chloroethylsulfonyl)-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 107652652 |
| Molecular Formula | C9H19ClN2O3S |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-[4-(2-chloroethylsulfonyl)-1,4-diazepan-1-yl]ethanol |
| SMILES | O=S(=O)(CCCl)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C9H19ClN2O3S/c10-2-9-16(14,15)12-4-1-3-11(5-6-12)7-8-13/h13H,1-9H2 |
| InChIKey | BRISMJSCVAPKCR-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|