C12H17Cl2N3O3S — CID 103833928
2-[4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol (PubChem CID 103833928) has the molecular formula C12H17Cl2N3O3S and a molecular weight of 354.26 g/mol. Its IUPAC name is 2-[4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 103833928 |
| Molecular Formula | C12H17Cl2N3O3S |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 2-[4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-1,4-diazepan-1-yl]ethanol |
| SMILES | O=S(=O)(c1cnc(Cl)c(Cl)c1)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C12H17Cl2N3O3S/c13-11-8-10(9-15-12(11)14)21(19,20)17-3-1-2-16(4-5-17)6-7-18/h8-9,18H,1-7H2 |
| InChIKey | IFJCTXIMVQXNFS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|