C11H17ClN4O3S — CID 64606200
2-[4-[(6-amino-5-chloro-3-pyridinyl)sulfonyl]piperazin-1-yl]ethanol (PubChem CID 64606200) has the molecular formula C11H17ClN4O3S and a molecular weight of 320.80 g/mol. Its IUPAC name is 2-[4-[(6-amino-5-chloro-3-pyridinyl)sulfonyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[(6-amino-5-chloro-3-pyridinyl)sulfonyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 64606200 |
| Molecular Formula | C11H17ClN4O3S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-[4-[(6-amino-5-chloro-3-pyridinyl)sulfonyl]piperazin-1-yl]ethanol |
| SMILES | Nc1ncc(S(=O)(=O)N2CCN(CCO)CC2)cc1Cl |
| InChI | InChI=1S/C11H17ClN4O3S/c12-10-7-9(8-14-11(10)13)20(18,19)16-3-1-15(2-4-16)5-6-17/h7-8,17H,1-6H2,(H2,13,14) |
| InChIKey | LSFGZQYTACQNGD-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 99.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |