C14H22ClN3O2S — CID 64601666
5-(4-tert-butylpiperidin-1-yl)sulfonyl-3-chloropyridin-2-amine (PubChem CID 64601666) has the molecular formula C14H22ClN3O2S and a molecular weight of 331.87 g/mol. Its IUPAC name is 5-(4-tert-butylpiperidin-1-yl)sulfonyl-3-chloropyridin-2-amine.
| Compound Name | 5-(4-tert-butylpiperidin-1-yl)sulfonyl-3-chloropyridin-2-amine |
|---|---|
| PubChem CID | 64601666 |
| Molecular Formula | C14H22ClN3O2S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 5-(4-tert-butylpiperidin-1-yl)sulfonyl-3-chloropyridin-2-amine |
| SMILES | CC(C)(C)C1CCN(S(=O)(=O)c2cnc(N)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H22ClN3O2S/c1-14(2,3)10-4-6-18(7-5-10)21(19,20)11-8-12(15)13(16)17-9-11/h8-10H,4-7H2,1-3H3,(H2,16,17) |
| InChIKey | UEPUHGRDDGBCRL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |