C13H18ClFN2O3S — CID 63310054
2-[4-(3-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanol (PubChem CID 63310054) has the molecular formula C13H18ClFN2O3S and a molecular weight of 336.82 g/mol. Its IUPAC name is 2-[4-(3-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanol.
| Compound Name | 2-[4-(3-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanol |
|---|---|
| PubChem CID | 63310054 |
| Molecular Formula | C13H18ClFN2O3S |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[4-(3-chloro-2-fluorophenyl)sulfonyl-1,4-diazepan-1-yl]ethanol |
| SMILES | O=S(=O)(c1cccc(Cl)c1F)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C13H18ClFN2O3S/c14-11-3-1-4-12(13(11)15)21(19,20)17-6-2-5-16(7-8-17)9-10-18/h1,3-4,18H,2,5-10H2 |
| InChIKey | HUUITWZSPDBBDX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |