C13H20N2O2S — CID 124619149
(3R)-3-methyl-1-[(3-methylphenyl)methylsulfonyl]piperazine (PubChem CID 124619149) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is (3R)-3-methyl-1-[(3-methylphenyl)methylsulfonyl]piperazine.
| Compound Name | (3R)-3-methyl-1-[(3-methylphenyl)methylsulfonyl]piperazine |
|---|---|
| PubChem CID | 124619149 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (3R)-3-methyl-1-[(3-methylphenyl)methylsulfonyl]piperazine |
| SMILES | Cc1cccc(CS(=O)(=O)N2CCN[C@H](C)C2)c1 |
| InChI | InChI=1S/C13H20N2O2S/c1-11-4-3-5-13(8-11)10-18(16,17)15-7-6-14-12(2)9-15/h3-5,8,12,14H,6-7,9-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | YXFHMTRCXZMVBP-GFCCVEGCSA-N |
| XLogP | 1.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |