C12H17Cl2FN2O2S — CID 120875739
(3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]-3-methylpiperazine;hydrochloride (PubChem CID 120875739) has the molecular formula C12H17Cl2FN2O2S and a molecular weight of 343.25 g/mol. Its IUPAC name is (3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]-3-methylpiperazine;hydrochloride.
| Compound Name | (3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]-3-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120875739 |
| Molecular Formula | C12H17Cl2FN2O2S |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (3S)-1-[(3-chloro-4-fluorophenyl)methylsulfonyl]-3-methylpiperazine;hydrochloride |
| SMILES | C[C@H]1CN(S(=O)(=O)Cc2ccc(F)c(Cl)c2)CCN1.Cl |
| InChI | InChI=1S/C12H16ClFN2O2S.ClH/c1-9-7-16(5-4-15-9)19(17,18)8-10-2-3-12(14)11(13)6-10;/h2-3,6,9,15H,4-5,7-8H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | FTPVMSVIXWRFQR-FVGYRXGTSA-N |
| XLogP | 2.02 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |