C11H15Cl3N2O2S — CID 119981931
1-(2,5-dichlorophenyl)sulfonyl-3-methylpiperazine;hydrochloride (PubChem CID 119981931) has the molecular formula C11H15Cl3N2O2S and a molecular weight of 345.68 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfonyl-3-methylpiperazine;hydrochloride.
| Compound Name | 1-(2,5-dichlorophenyl)sulfonyl-3-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 119981931 |
| Molecular Formula | C11H15Cl3N2O2S |
| Molecular Weight | 345.68 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfonyl-3-methylpiperazine;hydrochloride |
| SMILES | CC1CN(S(=O)(=O)c2cc(Cl)ccc2Cl)CCN1.Cl |
| InChI | InChI=1S/C11H14Cl2N2O2S.ClH/c1-8-7-15(5-4-14-8)18(16,17)11-6-9(12)2-3-10(11)13;/h2-3,6,8,14H,4-5,7H2,1H3;1H |
| InChIKey | FVWFEUNAUDVALM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |