C19H20ClF2NO2S — CID 11825520
4-(4-chlorophenyl)sulfonyl-1-[2-(2,4-difluorophenyl)ethyl]piperidine (PubChem CID 11825520) has the molecular formula C19H20ClF2NO2S and a molecular weight of 399.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-1-[2-(2,4-difluorophenyl)ethyl]piperidine.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-1-[2-(2,4-difluorophenyl)ethyl]piperidine |
|---|---|
| PubChem CID | 11825520 |
| Molecular Formula | C19H20ClF2NO2S |
| Molecular Weight | 399.89 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-1-[2-(2,4-difluorophenyl)ethyl]piperidine |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)C1CCN(CCc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C19H20ClF2NO2S/c20-15-2-5-17(6-3-15)26(24,25)18-8-11-23(12-9-18)10-7-14-1-4-16(21)13-19(14)22/h1-6,13,18H,7-12H2 |
| InChIKey | BXUOVUWILQWARZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.89 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |