C19H22Cl2FNO2S — CID 141037067
4-(2-chlorophenyl)sulfonyl-1-[2-(4-fluorophenyl)ethyl]piperidine;hydrochloride (PubChem CID 141037067) has the molecular formula C19H22Cl2FNO2S and a molecular weight of 418.36 g/mol. Its IUPAC name is 4-(2-chlorophenyl)sulfonyl-1-[2-(4-fluorophenyl)ethyl]piperidine;hydrochloride.
| Compound Name | 4-(2-chlorophenyl)sulfonyl-1-[2-(4-fluorophenyl)ethyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 141037067 |
| Molecular Formula | C19H22Cl2FNO2S |
| Molecular Weight | 418.36 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 4-(2-chlorophenyl)sulfonyl-1-[2-(4-fluorophenyl)ethyl]piperidine;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccccc1Cl)C1CCN(CCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H21ClFNO2S.ClH/c20-18-3-1-2-4-19(18)25(23,24)17-10-13-22(14-11-17)12-9-15-5-7-16(21)8-6-15;/h1-8,17H,9-14H2;1H |
| InChIKey | VTZRYVYNSZDVFV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |