C19H26Cl2N2O3S — CID 141036953
4-[2-[4-(2-methoxyphenyl)sulfonylpiperidin-1-yl]ethyl]pyridine;dihydrochloride (PubChem CID 141036953) has the molecular formula C19H26Cl2N2O3S and a molecular weight of 433.40 g/mol. Its IUPAC name is 4-[2-[4-(2-methoxyphenyl)sulfonylpiperidin-1-yl]ethyl]pyridine;dihydrochloride.
| Compound Name | 4-[2-[4-(2-methoxyphenyl)sulfonylpiperidin-1-yl]ethyl]pyridine;dihydrochloride |
|---|---|
| PubChem CID | 141036953 |
| Molecular Formula | C19H26Cl2N2O3S |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 4-[2-[4-(2-methoxyphenyl)sulfonylpiperidin-1-yl]ethyl]pyridine;dihydrochloride |
| SMILES | COc1ccccc1S(=O)(=O)C1CCN(CCc2ccncc2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H24N2O3S.2ClH/c1-24-18-4-2-3-5-19(18)25(22,23)17-9-14-21(15-10-17)13-8-16-6-11-20-12-7-16;;/h2-7,11-12,17H,8-10,13-15H2,1H3;2*1H |
| InChIKey | XLUKKKAHJAYXID-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |