C20H25ClFNOS — CID 141037033
1-[2-(4-fluorophenyl)ethyl]-4-(2-methoxyphenyl)sulfanylpiperidine;hydrochloride (PubChem CID 141037033) has the molecular formula C20H25ClFNOS and a molecular weight of 381.94 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)ethyl]-4-(2-methoxyphenyl)sulfanylpiperidine;hydrochloride.
| Compound Name | 1-[2-(4-fluorophenyl)ethyl]-4-(2-methoxyphenyl)sulfanylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 141037033 |
| Molecular Formula | C20H25ClFNOS |
| Molecular Weight | 381.94 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 1-[2-(4-fluorophenyl)ethyl]-4-(2-methoxyphenyl)sulfanylpiperidine;hydrochloride |
| SMILES | COc1ccccc1SC1CCN(CCc2ccc(F)cc2)CC1.Cl |
| InChI | InChI=1S/C20H24FNOS.ClH/c1-23-19-4-2-3-5-20(19)24-18-11-14-22(15-12-18)13-10-16-6-8-17(21)9-7-16;/h2-9,18H,10-15H2,1H3;1H |
| InChIKey | DRVKYHPBDOXVKN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.94 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |