C22H26FNO3 — CID 59915472
2-[[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-hydroxymethyl]-6-methoxybenzaldehyde (PubChem CID 59915472) has the molecular formula C22H26FNO3 and a molecular weight of 371.45 g/mol. Its IUPAC name is 2-[[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-hydroxymethyl]-6-methoxybenzaldehyde.
| Compound Name | 2-[[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-hydroxymethyl]-6-methoxybenzaldehyde |
|---|---|
| PubChem CID | 59915472 |
| Molecular Formula | C22H26FNO3 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 2-[[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]-hydroxymethyl]-6-methoxybenzaldehyde |
| SMILES | COc1cccc(C(O)C2CCN(CCc3ccc(F)cc3)CC2)c1C=O |
| InChI | InChI=1S/C22H26FNO3/c1-27-21-4-2-3-19(20(21)15-25)22(26)17-10-13-24(14-11-17)12-9-16-5-7-18(23)8-6-16/h2-8,15,17,22,26H,9-14H2,1H3 |
| InChIKey | NRHMNANFWSOBJF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|